C9H20ClN3O3S — CID 119704335
(2R)-N-[2-(methanesulfonamido)ethyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119704335) has the molecular formula C9H20ClN3O3S and a molecular weight of 285.80 g/mol. Its IUPAC name is (2R)-N-[2-(methanesulfonamido)ethyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[2-(methanesulfonamido)ethyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119704335 |
| Molecular Formula | C9H20ClN3O3S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2R)-N-[2-(methanesulfonamido)ethyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)NCCNC(=O)[C@H]1CCCCN1.Cl |
| InChI | InChI=1S/C9H19N3O3S.ClH/c1-16(14,15)12-7-6-11-9(13)8-4-2-3-5-10-8;/h8,10,12H,2-7H2,1H3,(H,11,13);1H/t8-;/m1./s1 |
| InChIKey | HKWCBCJJQPBMLX-DDWIOCJRSA-N |
| XLogP | -0.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|