C14H28ClN3O4S — CID 119323923
N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119323923) has the molecular formula C14H28ClN3O4S and a molecular weight of 369.92 g/mol. Its IUPAC name is N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119323923 |
| Molecular Formula | C14H28ClN3O4S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCS(=O)(=O)NCC1CCCCO1)C1CCCCN1 |
| InChI | InChI=1S/C14H27N3O4S.ClH/c18-14(13-6-1-3-7-15-13)16-8-10-22(19,20)17-11-12-5-2-4-9-21-12;/h12-13,15,17H,1-11H2,(H,16,18);1H |
| InChIKey | GJZCZWNGGYDJKN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |