C12H24ClN3O4S — CID 119782528
N-[2-(cyclobutylmethylsulfamoyl)ethyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119782528) has the molecular formula C12H24ClN3O4S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-[2-(cyclobutylmethylsulfamoyl)ethyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119782528 |
| Molecular Formula | C12H24ClN3O4S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCS(=O)(=O)NCC1CCC1)C1COCCN1 |
| InChI | InChI=1S/C12H23N3O4S.ClH/c16-12(11-9-19-6-4-13-11)14-5-7-20(17,18)15-8-10-2-1-3-10;/h10-11,13,15H,1-9H2,(H,14,16);1H |
| InChIKey | GWBBXIDWKXDYPY-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |