C9H20ClN3O3S — CID 119322955
2-amino-N-[2-(cyclobutylmethylsulfamoyl)ethyl]acetamide;hydrochloride (PubChem CID 119322955) has the molecular formula C9H20ClN3O3S and a molecular weight of 285.80 g/mol. Its IUPAC name is 2-amino-N-[2-(cyclobutylmethylsulfamoyl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(cyclobutylmethylsulfamoyl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119322955 |
| Molecular Formula | C9H20ClN3O3S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-amino-N-[2-(cyclobutylmethylsulfamoyl)ethyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCCS(=O)(=O)NCC1CCC1 |
| InChI | InChI=1S/C9H19N3O3S.ClH/c10-6-9(13)11-4-5-16(14,15)12-7-8-2-1-3-8;/h8,12H,1-7,10H2,(H,11,13);1H |
| InChIKey | JEUOGILBVIKHOI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |