C17H32ClN3O4S — CID 119323925
N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119323925) has the molecular formula C17H32ClN3O4S and a molecular weight of 409.98 g/mol. Its IUPAC name is N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119323925 |
| Molecular Formula | C17H32ClN3O4S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCS(=O)(=O)NCC1CCCCO1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H31N3O4S.ClH/c21-17(16-11-13-5-1-2-7-15(13)20-16)18-8-10-25(22,23)19-12-14-6-3-4-9-24-14;/h13-16,19-20H,1-12H2,(H,18,21);1H |
| InChIKey | LBNXQNINNKKAME-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |