C14H29N3O4S — CID 119784170
2-amino-2-methyl-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pentanamide (PubChem CID 119784170) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pentanamide.
| Compound Name | 2-amino-2-methyl-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 119784170 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-amino-2-methyl-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pentanamide |
| SMILES | CCCC(C)(N)C(=O)NCCS(=O)(=O)NCC1CCCCO1 |
| InChI | InChI=1S/C14H29N3O4S/c1-3-7-14(2,15)13(18)16-8-10-22(19,20)17-11-12-6-4-5-9-21-12/h12,17H,3-11,15H2,1-2H3,(H,16,18) |
| InChIKey | JLGLCAPUUKQKMJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |