C19H40IN5O3S — CID 111830458
2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 111830458) has the molecular formula C19H40IN5O3S and a molecular weight of 545.53 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111830458 |
| Molecular Formula | C19H40IN5O3S |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCCCO1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C19H39N5O3S.HI/c1-19(2,24-11-6-4-7-12-24)16-22-18(20-3)21-10-14-28(25,26)23-15-17-9-5-8-13-27-17;/h17,23H,4-16H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | KVRKTRWYJARWIB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|