C17H27ClN4O3S — CID 111828177
1-[(2-chlorophenyl)methyl]-2-methyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine (PubChem CID 111828177) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111828177 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCCCO1)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H27ClN4O3S/c1-19-17(21-12-14-6-2-3-8-16(14)18)20-9-11-26(23,24)22-13-15-7-4-5-10-25-15/h2-3,6,8,15,22H,4-5,7,9-13H2,1H3,(H2,19,20,21) |
| InChIKey | DSJHVFIIJVIZRV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|