C19H31FN4O3S — CID 111831276
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine (PubChem CID 111831276) has the molecular formula C19H31FN4O3S and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111831276 |
| Molecular Formula | C19H31FN4O3S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCCCO1)NCCc1ccccc1F |
| InChI | InChI=1S/C19H31FN4O3S/c1-2-21-19(22-11-10-16-7-3-4-9-18(16)20)23-12-14-28(25,26)24-15-17-8-5-6-13-27-17/h3-4,7,9,17,24H,2,5-6,8,10-15H2,1H3,(H2,21,22,23) |
| InChIKey | WCACGHBZWJFUHP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|