C20H34N4O4S — CID 111828039
1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine (PubChem CID 111828039) has the molecular formula C20H34N4O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111828039 |
| Molecular Formula | C20H34N4O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCCCO1)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H34N4O4S/c1-3-21-20(22-12-11-17-7-9-18(27-2)10-8-17)23-13-15-29(25,26)24-16-19-6-4-5-14-28-19/h7-10,19,24H,3-6,11-16H2,1-2H3,(H2,21,22,23) |
| InChIKey | PQFPXJFATSXQME-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|