C23H33IN4O3S — CID 111136046
1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111136046) has the molecular formula C23H33IN4O3S and a molecular weight of 572.51 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111136046 |
| Molecular Formula | C23H33IN4O3S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCCc1ccccc1.I |
| InChI | InChI=1S/C23H32N4O3S.HI/c1-2-24-23(25-15-14-19-7-4-3-5-8-19)26-17-20-10-12-22(13-11-20)31(28,29)27-18-21-9-6-16-30-21;/h3-5,7-8,10-13,21,27H,2,6,9,14-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | CMZZXCMSWOXPHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|