C18H26N4O3S — CID 111849151
1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylguanidine (PubChem CID 111849151) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylguanidine.
| Compound Name | 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111849151 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-ethyl-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/Cc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCC |
| InChI | InChI=1S/C18H26N4O3S/c1-3-11-20-18(19-4-2)21-13-15-7-9-17(10-8-15)26(23,24)22-14-16-6-5-12-25-16/h1,7-10,16,22H,4-6,11-14H2,2H3,(H2,19,20,21) |
| InChIKey | ANHRSFQKAKNRDE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|