C18H28N4O3S — CID 111072803
1-(cyclobutylmethyl)-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111072803) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111072803 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCC1CCC1 |
| InChI | InChI=1S/C18H28N4O3S/c19-18(20-11-14-3-1-4-14)21-12-15-6-8-17(9-7-15)26(23,24)22-13-16-5-2-10-25-16/h6-9,14,16,22H,1-5,10-13H2,(H3,19,20,21) |
| InChIKey | XEANAQGQWJQADR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|