C14H20N2O3S2 — CID 79186393
2-[4-(oxan-2-ylmethylsulfamoyl)phenyl]ethanethioamide (PubChem CID 79186393) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[4-(oxan-2-ylmethylsulfamoyl)phenyl]ethanethioamide.
| Compound Name | 2-[4-(oxan-2-ylmethylsulfamoyl)phenyl]ethanethioamide |
|---|---|
| PubChem CID | 79186393 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[4-(oxan-2-ylmethylsulfamoyl)phenyl]ethanethioamide |
| SMILES | NC(=S)Cc1ccc(S(=O)(=O)NCC2CCCCO2)cc1 |
| InChI | InChI=1S/C14H20N2O3S2/c15-14(20)9-11-4-6-13(7-5-11)21(17,18)16-10-12-3-1-2-8-19-12/h4-7,12,16H,1-3,8-10H2,(H2,15,20) |
| InChIKey | SIHVIVVQBASSNG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|