C14H23IN4O3S — CID 110917508
2-methyl-1-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110917508) has the molecular formula C14H23IN4O3S and a molecular weight of 454.33 g/mol. Its IUPAC name is 2-methyl-1-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110917508 |
| Molecular Formula | C14H23IN4O3S |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 2-methyl-1-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\N)NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1.I |
| InChI | InChI=1S/C14H22N4O3S.HI/c1-16-14(15)17-9-11-4-6-13(7-5-11)22(19,20)18-10-12-3-2-8-21-12;/h4-7,12,18H,2-3,8-10H2,1H3,(H3,15,16,17);1H |
| InChIKey | KAGHVRGGPFBVJD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|