C20H29IN4O3S2 — CID 111898278
2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111898278) has the molecular formula C20H29IN4O3S2 and a molecular weight of 564.52 g/mol. Its IUPAC name is 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111898278 |
| Molecular Formula | C20H29IN4O3S2 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C20H28N4O3S2.HI/c1-15-5-8-18(28-15)14-23-20(21-2)22-12-16-6-9-19(10-7-16)29(25,26)24-13-17-4-3-11-27-17;/h5-10,17,24H,3-4,11-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | GIFNNQLWGBGAEH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|