C15H24IN3O3S — CID 111137596
2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111137596) has the molecular formula C15H24IN3O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111137596 |
| Molecular Formula | C15H24IN3O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(C)(=O)=O)cc1)NCC1CCCO1.I |
| InChI | InChI=1S/C15H23N3O3S.HI/c1-16-15(18-11-13-4-3-9-21-13)17-10-12-5-7-14(8-6-12)22(2,19)20;/h5-8,13H,3-4,9-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | HDWHWJDPSCUSKF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|