C22H30FIN4O3S — CID 111846542
1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111846542) has the molecular formula C22H30FIN4O3S and a molecular weight of 576.48 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111846542 |
| Molecular Formula | C22H30FIN4O3S |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C22H29FN4O3S.HI/c1-16-5-6-18(12-21(16)23)14-26-22(24-2)25-13-17-7-9-20(10-8-17)31(28,29)27-15-19-4-3-11-30-19;/h5-10,12,19,27H,3-4,11,13-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XRIJULZBVSLQCX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|