C22H35IN4O3S — CID 111208826
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111208826) has the molecular formula C22H35IN4O3S and a molecular weight of 562.52 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111208826 |
| Molecular Formula | C22H35IN4O3S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCCCC1)NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1.I |
| InChI | InChI=1S/C22H34N4O3S.HI/c1-23-22(24-14-13-18-6-3-2-4-7-18)25-16-19-9-11-21(12-10-19)30(27,28)26-17-20-8-5-15-29-20;/h6,9-12,20,26H,2-5,7-8,13-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | MBCDDIJFPDAGGN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|