C18H29IN4O3S — CID 111962082
2-methyl-1-(2-methylcyclopropyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111962082) has the molecular formula C18H29IN4O3S and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111962082 |
| Molecular Formula | C18H29IN4O3S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NC1CC1C.I |
| InChI | InChI=1S/C18H28N4O3S.HI/c1-13-10-17(13)22-18(19-2)20-11-14-5-7-16(8-6-14)26(23,24)21-12-15-4-3-9-25-15;/h5-8,13,15,17,21H,3-4,9-12H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | YFBDPHUMXSUBSG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|