C20H33IN4O3S2 — CID 111528640
2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111528640) has the molecular formula C20H33IN4O3S2 and a molecular weight of 568.55 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111528640 |
| Molecular Formula | C20H33IN4O3S2 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C20H32N4O3S2.HI/c1-21-20(24-16-7-8-18(12-16)28-2)22-13-15-5-9-19(10-6-15)29(25,26)23-14-17-4-3-11-27-17;/h5-6,9-10,16-18,23H,3-4,7-8,11-14H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | DVZYDPDZRARPKB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|