C16H25N3O2S2 — CID 111529225
2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine (PubChem CID 111529225) has the molecular formula C16H25N3O2S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111529225 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-[(4-methylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(C)(=O)=O)cc1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C16H25N3O2S2/c1-17-16(19-13-6-7-14(10-13)22-2)18-11-12-4-8-15(9-5-12)23(3,20)21/h4-5,8-9,13-14H,6-7,10-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | HRUCZHORKFQIFP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|