C20H33IN4OS — CID 111530004
N,N-diethyl-4-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111530004) has the molecular formula C20H33IN4OS and a molecular weight of 504.48 g/mol. Its IUPAC name is N,N-diethyl-4-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-diethyl-4-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111530004 |
| Molecular Formula | C20H33IN4OS |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N,N-diethyl-4-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N\C)NC2CCC(SC)C2)cc1.I |
| InChI | InChI=1S/C20H32N4OS.HI/c1-5-24(6-2)19(25)16-9-7-15(8-10-16)14-22-20(21-3)23-17-11-12-18(13-17)26-4;/h7-10,17-18H,5-6,11-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | QHVZOFRDPSZZHK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|