C25H35N5O — CID 111924161
N,N-diethyl-4-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111924161) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N,N-diethyl-4-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111924161 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N,N-diethyl-4-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N\C)NC2CCN(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C25H35N5O/c1-5-29(6-2)24(31)21-11-9-20(10-12-21)17-27-25(26-4)28-22-15-16-30(18-22)23-13-7-19(3)8-14-23/h7-14,22H,5-6,15-18H2,1-4H3,(H2,26,27,28) |
| InChIKey | LXBFWMHJQSOCND-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|