C21H27N5O — CID 111923861
3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111923861) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111923861 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-[[[N'-methyl-N-[1-(4-methylphenyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(N)=O)c1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C21H27N5O/c1-15-6-8-19(9-7-15)26-11-10-18(14-26)25-21(23-2)24-13-16-4-3-5-17(12-16)20(22)27/h3-9,12,18H,10-11,13-14H2,1-2H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | SENKODHLNFPESL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|