C25H33N5O — CID 111911079
N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 111911079) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 111911079 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCCC2)c1)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C25H33N5O/c1-26-25(29-22-14-15-30(18-22)23-12-3-2-4-13-23)27-17-19-8-7-11-21(16-19)28-24(31)20-9-5-6-10-20/h2-4,7-8,11-13,16,20,22H,5-6,9-10,14-15,17-18H2,1H3,(H,28,31)(H2,26,27,29) |
| InChIKey | PVAUTQQLJWJPTQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|