C17H27IN4O — CID 110979598
N,N-diethyl-4-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide;hydroiodide (PubChem CID 110979598) has the molecular formula C17H27IN4O and a molecular weight of 430.33 g/mol. Its IUPAC name is N,N-diethyl-4-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-diethyl-4-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 110979598 |
| Molecular Formula | C17H27IN4O |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N,N-diethyl-4-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCc1ccc(C(=O)N(CC)CC)cc1.I |
| InChI | InChI=1S/C17H26N4O.HI/c1-5-12-19-17(18-4)20-13-14-8-10-15(11-9-14)16(22)21(6-2)7-3;/h5,8-11H,1,6-7,12-13H2,2-4H3,(H2,18,19,20);1H |
| InChIKey | PGKXEGOZYSJOMY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|