C24H34N4O — CID 111649548
4-[[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-diethylbenzamide (PubChem CID 111649548) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 111649548 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-[[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N/C)NCCc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C24H34N4O/c1-6-28(7-2)23(29)22-10-8-20(9-11-22)17-27-24(25-5)26-13-12-21-15-18(3)14-19(4)16-21/h8-11,14-16H,6-7,12-13,17H2,1-5H3,(H2,25,26,27) |
| InChIKey | KOXFLMYPZFZRLH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|