C20H29N5O4S — CID 109428389
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 109428389) has the molecular formula C20H29N5O4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109428389 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C20H29N5O4S/c1-14-15(2)29-19(25-14)13-23-20(21-3)22-11-16-6-8-18(9-7-16)30(26,27)24-12-17-5-4-10-28-17/h6-9,17,24H,4-5,10-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | IYXJNFLBGQAXOH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|