C20H42IN5O3S — CID 111831480
1-ethyl-2-[3-(2-methylpiperidin-1-yl)propyl]-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 111831480) has the molecular formula C20H42IN5O3S and a molecular weight of 559.56 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylpiperidin-1-yl)propyl]-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(2-methylpiperidin-1-yl)propyl]-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111831480 |
| Molecular Formula | C20H42IN5O3S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylpiperidin-1-yl)propyl]-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCCC1C)NCCS(=O)(=O)NCC1CCCCO1.I |
| InChI | InChI=1S/C20H41N5O3S.HI/c1-3-21-20(22-11-8-14-25-13-6-4-9-18(25)2)23-12-16-29(26,27)24-17-19-10-5-7-15-28-19;/h18-19,24H,3-17H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | JTJPPNRWKROKRN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|