C17H32IN5O4S — CID 109431898
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 109431898) has the molecular formula C17H32IN5O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109431898 |
| Molecular Formula | C17H32IN5O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCS(=O)(=O)NCC1CCCCO1.I |
| InChI | InChI=1S/C17H31N5O4S.HI/c1-4-18-17(20-12-16-22-13(2)14(3)26-16)19-8-10-27(23,24)21-11-15-7-5-6-9-25-15;/h15,21H,4-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | RTLCZBYDCMJRHC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|