C19H33IN4O6S — CID 111827846
2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111827846) has the molecular formula C19H33IN4O6S and a molecular weight of 572.47 g/mol. Its IUPAC name is 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111827846 |
| Molecular Formula | C19H33IN4O6S |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCCCO1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H32N4O6S.HI/c1-20-19(23-14-11-16(26-2)18(28-4)17(12-14)27-3)21-8-10-30(24,25)22-13-15-7-5-6-9-29-15;/h11-12,15,22H,5-10,13H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | WYVYCTJKWDGJBH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|