C16H24N2O5 — CID 108994315
2-(oxolan-2-ylmethylamino)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 108994315) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylamino)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(oxolan-2-ylmethylamino)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 108994315 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-(oxolan-2-ylmethylamino)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CNCC2CCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O5/c1-20-13-7-11(8-14(21-2)16(13)22-3)18-15(19)10-17-9-12-5-4-6-23-12/h7-8,12,17H,4-6,9-10H2,1-3H3,(H,18,19) |
| InChIKey | LPHOWCXWCUZAGD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |