C19H33IN4O3S — CID 111828616
2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111828616) has the molecular formula C19H33IN4O3S and a molecular weight of 524.47 g/mol. Its IUPAC name is 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111828616 |
| Molecular Formula | C19H33IN4O3S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 2-methyl-1-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)NCCS(=O)(=O)NCC1CCCCO1.I |
| InChI | InChI=1S/C19H32N4O3S.HI/c1-20-19(21-12-7-10-17-8-3-2-4-9-17)22-13-15-27(24,25)23-16-18-11-5-6-14-26-18;/h2-4,8-9,18,23H,5-7,10-16H2,1H3,(H2,20,21,22);1H |
| InChIKey | CIVOLLVMAYAJHE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|