C19H41BN2O5 — CID 164549584
ethane;ethylboronic acid;2-[(pyrrolidine-2-carbonylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 164549584) has the molecular formula C19H41BN2O5 and a molecular weight of 388.36 g/mol. Its IUPAC name is ethane;ethylboronic acid;2-[(pyrrolidine-2-carbonylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | ethane;ethylboronic acid;2-[(pyrrolidine-2-carbonylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164549584 |
| Molecular Formula | C19H41BN2O5 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | ethane;ethylboronic acid;2-[(pyrrolidine-2-carbonylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC.CC.CCB(O)O.O=C(NCC1CCCCC1C(=O)O)C1CCCN1 |
| InChI | InChI=1S/C13H22N2O3.C2H7BO2.2C2H6/c16-12(11-6-3-7-14-11)15-8-9-4-1-2-5-10(9)13(17)18;1-2-3(4)5;2*1-2/h9-11,14H,1-8H2,(H,15,16)(H,17,18);4-5H,2H2,1H3;2*1-2H3 |
| InChIKey | KWMMTDGHJRBJOA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|