C11H20N2OS — CID 103810053
(2S)-N-(2-prop-2-enylsulfanylethyl)piperidine-2-carboxamide (PubChem CID 103810053) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is (2S)-N-(2-prop-2-enylsulfanylethyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(2-prop-2-enylsulfanylethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103810053 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2S)-N-(2-prop-2-enylsulfanylethyl)piperidine-2-carboxamide |
| SMILES | C=CCSCCNC(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C11H20N2OS/c1-2-8-15-9-7-13-11(14)10-5-3-4-6-12-10/h2,10,12H,1,3-9H2,(H,13,14)/t10-/m0/s1 |
| InChIKey | OYNPMUNVASGIGN-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|