C11H20N2O3S — CID 119320148
methyl 2-[2-(piperidine-2-carbonylamino)ethylsulfanyl]acetate (PubChem CID 119320148) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is methyl 2-[2-(piperidine-2-carbonylamino)ethylsulfanyl]acetate.
| Compound Name | methyl 2-[2-(piperidine-2-carbonylamino)ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 119320148 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | methyl 2-[2-(piperidine-2-carbonylamino)ethylsulfanyl]acetate |
| SMILES | COC(=O)CSCCNC(=O)C1CCCCN1 |
| InChI | InChI=1S/C11H20N2O3S/c1-16-10(14)8-17-7-6-13-11(15)9-4-2-3-5-12-9/h9,12H,2-8H2,1H3,(H,13,15) |
| InChIKey | ASCOOEAHOZGMPS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|