C8H12F3N3O2S — CID 106428188
5-oxo-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-2-carboxamide (PubChem CID 106428188) has the molecular formula C8H12F3N3O2S and a molecular weight of 271.26 g/mol. Its IUPAC name is 5-oxo-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-2-carboxamide.
| Compound Name | 5-oxo-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 106428188 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-oxo-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)NCCSC(F)(F)F)CN1 |
| InChI | InChI=1S/C8H12F3N3O2S/c9-8(10,11)17-2-1-12-7(16)5-3-14-6(15)4-13-5/h5,13H,1-4H2,(H,12,16)(H,14,15) |
| InChIKey | BGKIJJAWBZLDLV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|