C10H20N2O3S — CID 66420493
N-[2-(2-hydroxyethoxy)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66420493) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66420493 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCOCCO |
| InChI | InChI=1S/C10H20N2O3S/c13-3-5-15-4-1-12-10(14)7-9-8-16-6-2-11-9/h9,11,13H,1-8H2,(H,12,14) |
| InChIKey | CTGQPFZIMCHTMH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|