C9H19N3O3S2 — CID 66421416
N-[2-(methanesulfonamido)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66421416) has the molecular formula C9H19N3O3S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66421416 |
| Molecular Formula | C9H19N3O3S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CS(=O)(=O)NCCNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C9H19N3O3S2/c1-17(14,15)12-3-2-11-9(13)6-8-7-16-5-4-10-8/h8,10,12H,2-7H2,1H3,(H,11,13) |
| InChIKey | HXRAZNNFUZZCDP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|