C9H14N2OS — CID 66421607
N-prop-2-ynyl-2-thiomorpholin-3-ylacetamide (PubChem CID 66421607) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N-prop-2-ynyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-prop-2-ynyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66421607 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-prop-2-ynyl-2-thiomorpholin-3-ylacetamide |
| SMILES | C#CCNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-3-11-9(12)6-8-7-13-5-4-10-8/h1,8,10H,3-7H2,(H,11,12) |
| InChIKey | AXKDECAIGCVZFM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|