C12H23N3O2S — CID 114167326
N,2,2-trimethyl-3-[(2-thiomorpholin-3-ylacetyl)amino]propanamide (PubChem CID 114167326) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[(2-thiomorpholin-3-ylacetyl)amino]propanamide.
| Compound Name | N,2,2-trimethyl-3-[(2-thiomorpholin-3-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 114167326 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N,2,2-trimethyl-3-[(2-thiomorpholin-3-ylacetyl)amino]propanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C12H23N3O2S/c1-12(2,11(17)13-3)8-15-10(16)6-9-7-18-5-4-14-9/h9,14H,4-8H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | RMYKEAWCHHTZFH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |