C13H25N3O2 — CID 106277030
N,2,2-trimethyl-3-[(2-piperidin-4-ylacetyl)amino]propanamide (PubChem CID 106277030) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[(2-piperidin-4-ylacetyl)amino]propanamide.
| Compound Name | N,2,2-trimethyl-3-[(2-piperidin-4-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 106277030 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N,2,2-trimethyl-3-[(2-piperidin-4-ylacetyl)amino]propanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C13H25N3O2/c1-13(2,12(18)14-3)9-16-11(17)8-10-4-6-15-7-5-10/h10,15H,4-9H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | PYBCGTGSLPKWQM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |