C10H16N2O — CID 61028682
2-piperidin-4-yl-N-prop-2-ynylacetamide (PubChem CID 61028682) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-piperidin-4-yl-N-prop-2-ynylacetamide.
| Compound Name | 2-piperidin-4-yl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 61028682 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-piperidin-4-yl-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C10H16N2O/c1-2-5-12-10(13)8-9-3-6-11-7-4-9/h1,9,11H,3-8H2,(H,12,13) |
| InChIKey | XNJWIIWCEYSGPW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|