C11H22N2O2S2 — CID 114163723
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 114163723) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 114163723 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | CSCC(C)(O)CNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C11H22N2O2S2/c1-11(15,8-16-2)7-13-10(14)5-9-6-17-4-3-12-9/h9,12,15H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | GCTGPXCRKCPHMI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |