C13H24N2O2S — CID 66422108
N-[(1-hydroxycyclohexyl)methyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66422108) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66422108 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C13H24N2O2S/c16-12(8-11-9-18-7-6-14-11)15-10-13(17)4-2-1-3-5-13/h11,14,17H,1-10H2,(H,15,16) |
| InChIKey | QDOLOKPBVRYTCQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |