C12H23ClN2OS2 — CID 119940106
N-[(2-methylthiolan-2-yl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119940106) has the molecular formula C12H23ClN2OS2 and a molecular weight of 310.92 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119940106 |
| Molecular Formula | C12H23ClN2OS2 |
| Molecular Weight | 310.92 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CC1(CNC(=O)CC2CSCCN2)CCCS1.Cl |
| InChI | InChI=1S/C12H22N2OS2.ClH/c1-12(3-2-5-17-12)9-14-11(15)7-10-8-16-6-4-13-10;/h10,13H,2-9H2,1H3,(H,14,15);1H |
| InChIKey | OJFDYYPHRYPXED-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |