C14H27ClN2O2S — CID 119940507
N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119940507) has the molecular formula C14H27ClN2O2S and a molecular weight of 322.90 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119940507 |
| Molecular Formula | C14H27ClN2O2S |
| Molecular Weight | 322.90 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | COCCC1(CNC(=O)CC2CSCCN2)CCC1.Cl |
| InChI | InChI=1S/C14H26N2O2S.ClH/c1-18-7-5-14(3-2-4-14)11-16-13(17)9-12-10-19-8-6-15-12;/h12,15H,2-11H2,1H3,(H,16,17);1H |
| InChIKey | ZGTDIVNJDMJBHY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.90 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |