C14H24N2O3S — CID 66422266
1-[(2-thiomorpholin-3-ylacetyl)amino]cycloheptane-1-carboxylic acid (PubChem CID 66422266) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 1-[(2-thiomorpholin-3-ylacetyl)amino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[(2-thiomorpholin-3-ylacetyl)amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 66422266 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-[(2-thiomorpholin-3-ylacetyl)amino]cycloheptane-1-carboxylic acid |
| SMILES | O=C(CC1CSCCN1)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C14H24N2O3S/c17-12(9-11-10-20-8-7-15-11)16-14(13(18)19)5-3-1-2-4-6-14/h11,15H,1-10H2,(H,16,17)(H,18,19) |
| InChIKey | AEVXNRUHYQYNTC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |