C16H22N2OS — CID 119935796
N-(1-phenylcyclobutyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119935796) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(1-phenylcyclobutyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1-phenylcyclobutyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935796 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-(1-phenylcyclobutyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C16H22N2OS/c19-15(11-14-12-20-10-9-17-14)18-16(7-4-8-16)13-5-2-1-3-6-13/h1-3,5-6,14,17H,4,7-12H2,(H,18,19) |
| InChIKey | YYWFVJYQAOVJJU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |